C27H27ClF2N4O7 — CID 170437891
5-chloro-4-fluoro-2-[4-fluoro-2-[[2-(6-methoxy-3-nitro-2-pyridinyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]benzoic acid (PubChem CID 170437891) has the molecular formula C27H27ClF2N4O7 and a molecular weight of 592.98 g/mol. Its IUPAC name is 5-chloro-4-fluoro-2-[4-fluoro-2-[[2-(6-methoxy-3-nitro-2-pyridinyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]benzoic acid.
| Compound Name | 5-chloro-4-fluoro-2-[4-fluoro-2-[[2-(6-methoxy-3-nitro-2-pyridinyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 170437891 |
| Molecular Formula | C27H27ClF2N4O7 |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 5-chloro-4-fluoro-2-[4-fluoro-2-[[2-(6-methoxy-3-nitro-2-pyridinyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]anilino]benzoic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(CCN(Cc2cc(F)ccc2Nc2cc(F)c(Cl)cc2C(=O)O)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C27H27ClF2N4O7/c1-27(2,3)41-26(37)33(10-9-21-23(34(38)39)7-8-24(32-21)40-4)14-15-11-16(29)5-6-20(15)31-22-13-19(30)18(28)12-17(22)25(35)36/h5-8,11-13,31H,9-10,14H2,1-4H3,(H,35,36) |
| InChIKey | OMOXODLFSOSIJN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 144.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|