C17H36OS — CID 170440311
6-(4,5,5-trimethyloctylsulfanyl)hexan-1-ol (PubChem CID 170440311) has the molecular formula C17H36OS and a molecular weight of 288.54 g/mol. Its IUPAC name is 6-(4,5,5-trimethyloctylsulfanyl)hexan-1-ol.
| Compound Name | 6-(4,5,5-trimethyloctylsulfanyl)hexan-1-ol |
|---|---|
| PubChem CID | 170440311 |
| Molecular Formula | C17H36OS |
| Molecular Weight | 288.54 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 6-(4,5,5-trimethyloctylsulfanyl)hexan-1-ol |
| SMILES | CCCC(C)(C)C(C)CCCSCCCCCCO |
| InChI | InChI=1S/C17H36OS/c1-5-12-17(3,4)16(2)11-10-15-19-14-9-7-6-8-13-18/h16,18H,5-15H2,1-4H3 |
| InChIKey | BTIJHUQZXIGJPC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|