C56H37N5 — CID 170441597
8-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole (PubChem CID 170441597) has the molecular formula C56H37N5 and a molecular weight of 779.95 g/mol. Its IUPAC name is 8-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole.
| Compound Name | 8-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole |
|---|---|
| PubChem CID | 170441597 |
| Molecular Formula | C56H37N5 |
| Molecular Weight | 779.95 g/mol |
| Exact Mass | 779.30 |
| IUPAC Name | 8-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4ccc5cc(-c6ccccc6)c6c(-c7ccccc7)nn(-c7ccccc7)c6c5c4)n3)c2)cc1 |
| InChI | InChI=1S/C56H37N5/c1-6-18-38(19-7-1)42-26-16-28-45(34-42)54-57-55(46-29-17-27-43(35-46)39-20-8-2-9-21-39)59-56(58-54)47-33-32-44-36-49(40-22-10-3-11-23-40)51-52(41-24-12-4-13-25-41)60-61(53(51)50(44)37-47)48-30-14-5-15-31-48/h1-37H |
| InChIKey | SETMFLALWFGMBR-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.95 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |