C51H34N4 — CID 170441150
3-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,4-diphenylbenzo[g]indazole (PubChem CID 170441150) has the molecular formula C51H34N4 and a molecular weight of 702.86 g/mol. Its IUPAC name is 3-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,4-diphenylbenzo[g]indazole.
| Compound Name | 3-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,4-diphenylbenzo[g]indazole |
|---|---|
| PubChem CID | 170441150 |
| Molecular Formula | C51H34N4 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | 3-[4-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,4-diphenylbenzo[g]indazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-c5nn(-c6ccccc6)c6c5c(-c5ccccc5)cc5ccccc56)cc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C51H34N4/c1-5-15-37(16-6-1)45-33-42-21-13-14-24-44(42)50-48(45)49(54-55(50)43-22-11-4-12-23-43)40-31-27-36(28-32-40)35-25-29-39(30-26-35)47-34-46(38-17-7-2-8-18-38)52-51(53-47)41-19-9-3-10-20-41/h1-34H |
| InChIKey | AUJFDGAWIOTCGB-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |