C46H31N3 — CID 170441523
7-(2,6-diphenyl-4-pyridinyl)-1,3,4-triphenylbenzo[g]indazole (PubChem CID 170441523) has the molecular formula C46H31N3 and a molecular weight of 625.78 g/mol. Its IUPAC name is 7-(2,6-diphenyl-4-pyridinyl)-1,3,4-triphenylbenzo[g]indazole.
| Compound Name | 7-(2,6-diphenyl-4-pyridinyl)-1,3,4-triphenylbenzo[g]indazole |
|---|---|
| PubChem CID | 170441523 |
| Molecular Formula | C46H31N3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 7-(2,6-diphenyl-4-pyridinyl)-1,3,4-triphenylbenzo[g]indazole |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)cc(-c3ccccc3)c3c(-c5ccccc5)nn(-c5ccccc5)c34)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H31N3/c1-6-16-32(17-7-1)41-29-38-28-36(37-30-42(33-18-8-2-9-19-33)47-43(31-37)34-20-10-3-11-21-34)26-27-40(38)46-44(41)45(35-22-12-4-13-23-35)48-49(46)39-24-14-5-15-25-39/h1-31H |
| InChIKey | MYOVPOLAZJBSJM-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |