C57H36N4S — CID 170441551
7-[6-(4-dibenzothiophen-4-ylphenyl)-2-phenylpyrimidin-4-yl]-1,3,4-triphenylbenzo[g]indazole (PubChem CID 170441551) has the molecular formula C57H36N4S and a molecular weight of 809.01 g/mol. Its IUPAC name is 7-[6-(4-dibenzothiophen-4-ylphenyl)-2-phenylpyrimidin-4-yl]-1,3,4-triphenylbenzo[g]indazole.
| Compound Name | 7-[6-(4-dibenzothiophen-4-ylphenyl)-2-phenylpyrimidin-4-yl]-1,3,4-triphenylbenzo[g]indazole |
|---|---|
| PubChem CID | 170441551 |
| Molecular Formula | C57H36N4S |
| Molecular Weight | 809.01 g/mol |
| Exact Mass | 808.27 |
| IUPAC Name | 7-[6-(4-dibenzothiophen-4-ylphenyl)-2-phenylpyrimidin-4-yl]-1,3,4-triphenylbenzo[g]indazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cccc5c4sc4ccccc45)cc3)cc(-c3ccc4c(c3)cc(-c3ccccc3)c3c(-c5ccccc5)nn(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C57H36N4S/c1-5-16-37(17-6-1)49-35-43-34-42(32-33-45(43)55-53(49)54(40-18-7-2-8-19-40)60-61(55)44-22-11-4-12-23-44)51-36-50(58-57(59-51)41-20-9-3-10-21-41)39-30-28-38(29-31-39)46-25-15-26-48-47-24-13-14-27-52(47)62-56(46)48/h1-36H |
| InChIKey | CJHQYFRXVWZEDK-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.01 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |