C20H24N2O2 — CID 170442146
ethyl 4-ethyl-6-methyl-2-[4-(1-methylcyclopropyl)phenyl]pyrimidine-5-carboxylate (PubChem CID 170442146) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl 4-ethyl-6-methyl-2-[4-(1-methylcyclopropyl)phenyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-ethyl-6-methyl-2-[4-(1-methylcyclopropyl)phenyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 170442146 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | ethyl 4-ethyl-6-methyl-2-[4-(1-methylcyclopropyl)phenyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2ccc(C3(C)CC3)cc2)nc1CC |
| InChI | InChI=1S/C20H24N2O2/c1-5-16-17(19(23)24-6-2)13(3)21-18(22-16)14-7-9-15(10-8-14)20(4)11-12-20/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | RVEBZDSARIERLD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |