About 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide
1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide (PubChem CID 170442478) has the molecular formula C16H19ClN2O2
and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide.
Molecular Properties
| Compound Name | 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide |
| PubChem CID | 170442478 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide |
| SMILES | NC(=O)C1CCC2(Cc3ccccc3N(C(=O)CCl)C2)C1 |
| InChI | InChI=1S/C16H19ClN2O2/c17-9-14(20)19-10-16(6-5-12(8-16)15(18)21)7-11-3-1-2-4-13(11)19/h1-4,12H,5-10H2,(H2,18,21) |
| InChIKey | HZWHMCPDANQZJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide?
The IUPAC name of 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide (CID 170442478) is 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide.
What is the SMILES notation for 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide?
The canonical SMILES for 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide is NC(=O)C1CCC2(Cc3ccccc3N(C(=O)CCl)C2)C1.
What is the InChIKey of 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide?
The InChIKey is HZWHMCPDANQZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O2/c17-9-14(20)19-10-16(6-5-12(8-16)15(18)21)7-11-3-1-2-4-13(11)19/h1-4,12H,5-10H2,(H2,18,21).
What are the key properties of 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide?
1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide has a molecular weight of 306.79 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroacetyl)spiro[2,4-dihydroquinoline-3,3'-cyclopentane]-1'-carboxamide is sourced from PubChem (CID 170442478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).