C15H23N3O6 — CID 170443611
propan-2-yl (2S)-6-diazo-2-[(3-methoxyoxolane-3-carbonyl)amino]-5-oxohexanoate (PubChem CID 170443611) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[(3-methoxyoxolane-3-carbonyl)amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[(3-methoxyoxolane-3-carbonyl)amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443611 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[(3-methoxyoxolane-3-carbonyl)amino]-5-oxohexanoate |
| SMILES | COC1(C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C)CCOC1 |
| InChI | InChI=1S/C15H23N3O6/c1-10(2)24-13(20)12(5-4-11(19)8-17-16)18-14(21)15(22-3)6-7-23-9-15/h8,10,12H,4-7,9H2,1-3H3,(H,18,21)/t12-,15?/m0/s1 |
| InChIKey | URWSYELXAONATH-SFVWDYPZSA-N |
| XLogP | -0.12 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|