C7H12O2 — CID 170449125
1-[(1S,2S)-2-(1-hydroxyethyl)cyclopropyl]ethanone (PubChem CID 170449125) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(1-hydroxyethyl)cyclopropyl]ethanone.
| Compound Name | 1-[(1S,2S)-2-(1-hydroxyethyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 170449125 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1-[(1S,2S)-2-(1-hydroxyethyl)cyclopropyl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@@H]1C(C)O |
| InChI | InChI=1S/C7H12O2/c1-4(8)6-3-7(6)5(2)9/h4,6-8H,3H2,1-2H3/t4?,6-,7-/m1/s1 |
| InChIKey | YEWDYODNPMDAPT-AMUJUKTHSA-N |
| XLogP | 0.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |