About (2S)-4-(prop-2-ynylamino)butane-1,2-diol
(2S)-4-(prop-2-ynylamino)butane-1,2-diol (PubChem CID 170451741) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is (2S)-4-(prop-2-ynylamino)butane-1,2-diol.
Molecular Properties
| Compound Name | (2S)-4-(prop-2-ynylamino)butane-1,2-diol |
| PubChem CID | 170451741 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2S)-4-(prop-2-ynylamino)butane-1,2-diol |
| SMILES | C#CCNCC[C@H](O)CO |
| InChI | InChI=1S/C7H13NO2/c1-2-4-8-5-3-7(10)6-9/h1,7-10H,3-6H2/t7-/m0/s1 |
| InChIKey | OWWJERQZAMYYLT-ZETCQYMHSA-N |
| XLogP | -1.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-(prop-2-ynylamino)butane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(prop-2-ynylamino)butane-1,2-diol?
The IUPAC name of (2S)-4-(prop-2-ynylamino)butane-1,2-diol (CID 170451741) is (2S)-4-(prop-2-ynylamino)butane-1,2-diol.
What is the SMILES notation for (2S)-4-(prop-2-ynylamino)butane-1,2-diol?
The canonical SMILES for (2S)-4-(prop-2-ynylamino)butane-1,2-diol is C#CCNCC[C@H](O)CO.
What is the InChIKey of (2S)-4-(prop-2-ynylamino)butane-1,2-diol?
The InChIKey is OWWJERQZAMYYLT-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-4-8-5-3-7(10)6-9/h1,7-10H,3-6H2/t7-/m0/s1.
What are the key properties of (2S)-4-(prop-2-ynylamino)butane-1,2-diol?
(2S)-4-(prop-2-ynylamino)butane-1,2-diol has a molecular weight of 143.19 g/mol, XLogP of -1.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(prop-2-ynylamino)butane-1,2-diol is sourced from PubChem (CID 170451741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).