C16H19N7O2S2 — CID 170453995
4-(7,9-diamino-6,8,10-triazaspiro[4.5]deca-6,8-dien-10-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 170453995) has the molecular formula C16H19N7O2S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is 4-(7,9-diamino-6,8,10-triazaspiro[4.5]deca-6,8-dien-10-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-(7,9-diamino-6,8,10-triazaspiro[4.5]deca-6,8-dien-10-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 170453995 |
| Molecular Formula | C16H19N7O2S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 4-(7,9-diamino-6,8,10-triazaspiro[4.5]deca-6,8-dien-10-yl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | NC1=NC2(CCCC2)N(c2ccc(S(=O)(=O)Nc3nccs3)cc2)C(N)=N1 |
| InChI | InChI=1S/C16H19N7O2S2/c17-13-20-14(18)23(16(21-13)7-1-2-8-16)11-3-5-12(6-4-11)27(24,25)22-15-19-9-10-26-15/h3-6,9-10H,1-2,7-8H2,(H,19,22)(H4,17,18,20,21) |
| InChIKey | GRYUXQYMEZGPFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |