C16H18FN3O4 — CID 170455415
1-ethyl-6-fluoro-4-oxo-7-[2-(2-oxoethylamino)ethylamino]quinoline-3-carboxylic acid (PubChem CID 170455415) has the molecular formula C16H18FN3O4 and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-4-oxo-7-[2-(2-oxoethylamino)ethylamino]quinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-4-oxo-7-[2-(2-oxoethylamino)ethylamino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 170455415 |
| Molecular Formula | C16H18FN3O4 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-[2-(2-oxoethylamino)ethylamino]quinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(NCCNCC=O)cc21 |
| InChI | InChI=1S/C16H18FN3O4/c1-2-20-9-11(16(23)24)15(22)10-7-12(17)13(8-14(10)20)19-4-3-18-5-6-21/h6-9,18-19H,2-5H2,1H3,(H,23,24) |
| InChIKey | OYZFNHQCCXKPGB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|