C14H10F2O2 — CID 170457664
3,5-difluoro-2-(3-methoxyphenyl)benzaldehyde (PubChem CID 170457664) has the molecular formula C14H10F2O2 and a molecular weight of 248.23 g/mol. Its IUPAC name is 3,5-difluoro-2-(3-methoxyphenyl)benzaldehyde.
| Compound Name | 3,5-difluoro-2-(3-methoxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 170457664 |
| Molecular Formula | C14H10F2O2 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3,5-difluoro-2-(3-methoxyphenyl)benzaldehyde |
| SMILES | COc1cccc(-c2c(F)cc(F)cc2C=O)c1 |
| InChI | InChI=1S/C14H10F2O2/c1-18-12-4-2-3-9(6-12)14-10(8-17)5-11(15)7-13(14)16/h2-8H,1H3 |
| InChIKey | RQKMLXVEVRPOLQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|