About cyclohexyl(dimethyl)azanium tritetrafluoroborate
cyclohexyl(dimethyl)azanium tritetrafluoroborate (PubChem CID 170457833) has the molecular formula C8H18B3F12N-2
and a molecular weight of 388.65 g/mol. Its IUPAC name is cyclohexyl(dimethyl)azanium tritetrafluoroborate.
Molecular Properties
| Compound Name | cyclohexyl(dimethyl)azanium tritetrafluoroborate |
| PubChem CID | 170457833 |
| Molecular Formula | C8H18B3F12N-2 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | cyclohexyl(dimethyl)azanium tritetrafluoroborate |
| SMILES | C[NH+](C)C1CCCCC1.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C8H17N.3BF4/c1-9(2)8-6-4-3-5-7-8;3*2-1(3,4)5/h8H,3-7H2,1-2H3;;;/q;3*-1/p+1 |
| InChIKey | RWESCJJMFNMCTM-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(dimethyl)azanium tritetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(dimethyl)azanium tritetrafluoroborate?
The IUPAC name of cyclohexyl(dimethyl)azanium tritetrafluoroborate (CID 170457833) is cyclohexyl(dimethyl)azanium tritetrafluoroborate.
What is the SMILES notation for cyclohexyl(dimethyl)azanium tritetrafluoroborate?
The canonical SMILES for cyclohexyl(dimethyl)azanium tritetrafluoroborate is C[NH+](C)C1CCCCC1.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of cyclohexyl(dimethyl)azanium tritetrafluoroborate?
The InChIKey is RWESCJJMFNMCTM-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17N.3BF4/c1-9(2)8-6-4-3-5-7-8;3*2-1(3,4)5/h8H,3-7H2,1-2H3;;;/q;3*-1/p+1.
What are the key properties of cyclohexyl(dimethyl)azanium tritetrafluoroborate?
cyclohexyl(dimethyl)azanium tritetrafluoroborate has a molecular weight of 388.65 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(dimethyl)azanium tritetrafluoroborate is sourced from PubChem (CID 170457833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).