C15H26BF4N2- — CID 174863635
1,3-dicyclohexyl-2H-imidazole tetrafluoroborate (PubChem CID 174863635) has the molecular formula C15H26BF4N2- and a molecular weight of 321.19 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2H-imidazole tetrafluoroborate.
| Compound Name | 1,3-dicyclohexyl-2H-imidazole tetrafluoroborate |
|---|---|
| PubChem CID | 174863635 |
| Molecular Formula | C15H26BF4N2- |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1,3-dicyclohexyl-2H-imidazole tetrafluoroborate |
| SMILES | C1=CN(C2CCCCC2)CN1C1CCCCC1.F[B-](F)(F)F |
| InChI | InChI=1S/C15H26N2.BF4/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;2-1(3,4)5/h11-12,14-15H,1-10,13H2;/q;-1 |
| InChIKey | NOIPFASZMADFRS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|