C15H28N2O — CID 174895772
1,3-dicyclohexyl-2H-imidazole;hydrate (PubChem CID 174895772) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2H-imidazole;hydrate.
| Compound Name | 1,3-dicyclohexyl-2H-imidazole;hydrate |
|---|---|
| PubChem CID | 174895772 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1,3-dicyclohexyl-2H-imidazole;hydrate |
| SMILES | C1=CN(C2CCCCC2)CN1C1CCCCC1.O |
| InChI | InChI=1S/C15H26N2.H2O/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;/h11-12,14-15H,1-10,13H2;1H2 |
| InChIKey | GTNOVTOMILNZMD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |