C16H30N2Se2 — CID 11112323
3,7-dicyclohexyl-1,5,3,7-diselenadiazocane (PubChem CID 11112323) has the molecular formula C16H30N2Se2 and a molecular weight of 408.35 g/mol. Its IUPAC name is 3,7-dicyclohexyl-1,5,3,7-diselenadiazocane.
| Compound Name | 3,7-dicyclohexyl-1,5,3,7-diselenadiazocane |
|---|---|
| PubChem CID | 11112323 |
| Molecular Formula | C16H30N2Se2 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3,7-dicyclohexyl-1,5,3,7-diselenadiazocane |
| SMILES | C1CCC(N2C[Se]CN(C3CCCCC3)C[Se]C2)CC1 |
| InChI | InChI=1S/C16H30N2Se2/c1-3-7-15(8-4-1)17-11-19-13-18(14-20-12-17)16-9-5-2-6-10-16/h15-16H,1-14H2 |
| InChIKey | WAIZNOQBDBLWMQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|