C21H32N4O2S — CID 174696108
[4-[[4-(3-cyclohexyl-2H-imidazol-1-yl)phenyl]methyl]piperazin-1-yl]methanesulfinic acid (PubChem CID 174696108) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is [4-[[4-(3-cyclohexyl-2H-imidazol-1-yl)phenyl]methyl]piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-[[4-(3-cyclohexyl-2H-imidazol-1-yl)phenyl]methyl]piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174696108 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [4-[[4-(3-cyclohexyl-2H-imidazol-1-yl)phenyl]methyl]piperazin-1-yl]methanesulfinic acid |
| SMILES | O=S(O)CN1CCN(Cc2ccc(N3C=CN(C4CCCCC4)C3)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O2S/c26-28(27)18-23-12-10-22(11-13-23)16-19-6-8-21(9-7-19)25-15-14-24(17-25)20-4-2-1-3-5-20/h6-9,14-15,20H,1-5,10-13,16-18H2,(H,26,27) |
| InChIKey | YMAQYNBPHCZSTR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|