C14H16N4O3S — CID 170458603
6-amino-2-sulfanylidene-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carbonitrile (PubChem CID 170458603) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-amino-2-sulfanylidene-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-amino-2-sulfanylidene-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 170458603 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-amino-2-sulfanylidene-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(C2NC(=S)NC(N)=C2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N4O3S/c1-19-9-4-7(5-10(20-2)12(9)21-3)11-8(6-15)13(16)18-14(22)17-11/h4-5,11H,16H2,1-3H3,(H2,17,18,22) |
| InChIKey | RPEJGBUOXGYQJB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|