C28H21N5OS — CID 170458899
N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 170458899) has the molecular formula C28H21N5OS and a molecular weight of 475.58 g/mol. Its IUPAC name is N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 170458899 |
| Molecular Formula | C28H21N5OS |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[(E)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2csc(N/N=C/c3cn(-c4ccccc4)nc3-c3cc4ccccc4o3)n2)cc1 |
| InChI | InChI=1S/C28H21N5OS/c1-19-11-13-20(14-12-19)24-18-35-28(30-24)31-29-16-22-17-33(23-8-3-2-4-9-23)32-27(22)26-15-21-7-5-6-10-25(21)34-26/h2-18H,1H3,(H,30,31)/b29-16+ |
| InChIKey | SAMDFVQZEUJFDV-MUFRIFMGSA-N |
| XLogP | 7.16 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|