About [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate
[(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate (PubChem CID 170458940) has the molecular formula C36H29O8Sb
and a molecular weight of 711.38 g/mol. Its IUPAC name is [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate |
| PubChem CID | 170458940 |
| Molecular Formula | C36H29O8Sb |
| Molecular Weight | 711.38 g/mol |
| Exact Mass | 710.09 |
| IUPAC Name | [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)O[Sb](OC(=O)c1ccccc1OC(C)=O)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C9H8O4.3C6H5.Sb/c2*1-6(10)13-8-5-3-2-4-7(8)9(11)12;3*1-2-4-6-5-3-1;/h2*2-5H,1H3,(H,11,12);3*1-5H;/q;;;;;+2/p-2 |
| InChIKey | NUXLUIVGMCKLEH-UHFFFAOYSA-L |
| XLogP | 4.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 711.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate?
The IUPAC name of [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate (CID 170458940) is [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate.
What is the SMILES notation for [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate?
The canonical SMILES for [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)O[Sb](OC(=O)c1ccccc1OC(C)=O)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate?
The InChIKey is NUXLUIVGMCKLEH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H8O4.3C6H5.Sb/c2*1-6(10)13-8-5-3-2-4-7(8)9(11)12;3*1-2-4-6-5-3-1;/h2*2-5H,1H3,(H,11,12);3*1-5H;/q;;;;;+2/p-2.
What are the key properties of [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate?
[(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate has a molecular weight of 711.38 g/mol, XLogP of 4.67, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-acetyloxybenzoyl)oxy-triphenyl-λ5-stibanyl] 2-acetyloxybenzoate is sourced from PubChem (CID 170458940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).