C42H32N12 — CID 170458946
1H-imidazol-4-yl-[4-[1,2,2-tris[4-(1H-imidazole-4-carboximidoyl)phenyl]ethenyl]phenyl]methanimine (PubChem CID 170458946) has the molecular formula C42H32N12 and a molecular weight of 704.80 g/mol. Its IUPAC name is 1H-imidazol-4-yl-[4-[1,2,2-tris[4-(1H-imidazole-4-carboximidoyl)phenyl]ethenyl]phenyl]methanimine.
| Compound Name | 1H-imidazol-4-yl-[4-[1,2,2-tris[4-(1H-imidazole-4-carboximidoyl)phenyl]ethenyl]phenyl]methanimine |
|---|---|
| PubChem CID | 170458946 |
| Molecular Formula | C42H32N12 |
| Molecular Weight | 704.80 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 1H-imidazol-4-yl-[4-[1,2,2-tris[4-(1H-imidazole-4-carboximidoyl)phenyl]ethenyl]phenyl]methanimine |
| SMILES | [H]/N=C(/c1ccc(C(=C(c2ccc(/C(=N/[H])c3c[nH]cn3)cc2)c2ccc(/C(=N/[H])c3c[nH]cn3)cc2)c2ccc(/C(=N/[H])c3c[nH]cn3)cc2)cc1)c1c[nH]cn1 |
| InChI | InChI=1S/C42H32N12/c43-39(33-17-47-21-51-33)29-9-1-25(2-10-29)37(26-3-11-30(12-4-26)40(44)34-18-48-22-52-34)38(27-5-13-31(14-6-27)41(45)35-19-49-23-53-35)28-7-15-32(16-8-28)42(46)36-20-50-24-54-36/h1-24,43-46H,(H,47,51)(H,48,52)(H,49,53)(H,50,54)/b43-39-,44-40-,45-41-,46-42- |
| InChIKey | NCSLPTNKRMYNLG-DONDIPARSA-N |
| XLogP | 7.25 |
| TPSA | 210.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|