C14H10N2O4 — CID 170460064
5-hydroxy-6-methyl-3-phenylpyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 170460064) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-3-phenylpyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-hydroxy-6-methyl-3-phenylpyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 170460064 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-hydroxy-6-methyl-3-phenylpyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1c(O)c2c(=O)n(-c3ccccc3)cnc2oc1=O |
| InChI | InChI=1S/C14H10N2O4/c1-8-11(17)10-12(20-14(8)19)15-7-16(13(10)18)9-5-3-2-4-6-9/h2-7,17H,1H3 |
| InChIKey | JSKHUNGGYIEGNZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |