C28H27NO4S — CID 170461580
9H-fluoren-9-ylmethyl N-[4-(3-propan-2-ylsulfonylphenyl)but-3-ynyl]carbamate (PubChem CID 170461580) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-propan-2-ylsulfonylphenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-propan-2-ylsulfonylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461580 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-propan-2-ylsulfonylphenyl)but-3-ynyl]carbamate |
| SMILES | CC(C)S(=O)(=O)c1cccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C28H27NO4S/c1-20(2)34(31,32)22-12-9-11-21(18-22)10-7-8-17-29-28(30)33-19-27-25-15-5-3-13-23(25)24-14-4-6-16-26(24)27/h3-6,9,11-16,18,20,27H,8,17,19H2,1-2H3,(H,29,30) |
| InChIKey | SNUMUAXEFDRSFI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|