C28H26N2O4S — CID 170461709
9H-fluoren-9-ylmethyl N-[4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ynyl]carbamate (PubChem CID 170461709) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461709 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cccc(N2CCCS2(=O)=O)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H26N2O4S/c31-28(34-20-27-25-14-3-1-12-23(25)24-13-2-4-15-26(24)27)29-16-6-5-9-21-10-7-11-22(19-21)30-17-8-18-35(30,32)33/h1-4,7,10-15,19,27H,6,8,16-18,20H2,(H,29,31) |
| InChIKey | REWRVORJOQMYPF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|