C12H15FN2 — CID 170464291
4-[2-(aminomethyl)-5-fluorophenyl]-N-methylbut-3-yn-1-amine (PubChem CID 170464291) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-5-fluorophenyl]-N-methylbut-3-yn-1-amine.
| Compound Name | 4-[2-(aminomethyl)-5-fluorophenyl]-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170464291 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-[2-(aminomethyl)-5-fluorophenyl]-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1cc(F)ccc1CN |
| InChI | InChI=1S/C12H15FN2/c1-15-7-3-2-4-10-8-12(13)6-5-11(10)9-14/h5-6,8,15H,3,7,9,14H2,1H3 |
| InChIKey | AVHKMOWRTRVOKZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|