C11H8BrNS — CID 170466233
6-(4-bromobut-1-ynyl)-1,3-benzothiazole (PubChem CID 170466233) has the molecular formula C11H8BrNS and a molecular weight of 266.16 g/mol. Its IUPAC name is 6-(4-bromobut-1-ynyl)-1,3-benzothiazole.
| Compound Name | 6-(4-bromobut-1-ynyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 170466233 |
| Molecular Formula | C11H8BrNS |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | 6-(4-bromobut-1-ynyl)-1,3-benzothiazole |
| SMILES | BrCCC#Cc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H8BrNS/c12-6-2-1-3-9-4-5-10-11(7-9)14-8-13-10/h4-5,7-8H,2,6H2 |
| InChIKey | XJBPRSWSMZTKMP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|