C11H9BrN2 — CID 170466224
6-(4-bromobut-1-ynyl)-1H-pyrrolo[3,2-b]pyridine (PubChem CID 170466224) has the molecular formula C11H9BrN2 and a molecular weight of 249.11 g/mol. Its IUPAC name is 6-(4-bromobut-1-ynyl)-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 6-(4-bromobut-1-ynyl)-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 170466224 |
| Molecular Formula | C11H9BrN2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 6-(4-bromobut-1-ynyl)-1H-pyrrolo[3,2-b]pyridine |
| SMILES | BrCCC#Cc1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H9BrN2/c12-5-2-1-3-9-7-11-10(14-8-9)4-6-13-11/h4,6-8,13H,2,5H2 |
| InChIKey | GGZVVNFXKGWAHG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|