C9H10N2O — CID 89389519
2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol (PubChem CID 89389519) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol.
| Compound Name | 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol |
|---|---|
| PubChem CID | 89389519 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol |
| SMILES | OCCc1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H10N2O/c12-4-2-7-5-9-8(11-6-7)1-3-10-9/h1,3,5-6,10,12H,2,4H2 |
| InChIKey | HHDSETNLZANFMQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |