About 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol
2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol (PubChem CID 89389519) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol |
| PubChem CID | 89389519 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol |
| SMILES | OCCc1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C9H10N2O/c12-4-2-7-5-9-8(11-6-7)1-3-10-9/h1,3,5-6,10,12H,2,4H2 |
| InChIKey | HHDSETNLZANFMQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol?
The IUPAC name of 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol (CID 89389519) is 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol.
What is the SMILES notation for 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol?
The canonical SMILES for 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol is OCCc1cnc2cc[nH]c2c1.
What is the InChIKey of 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol?
The InChIKey is HHDSETNLZANFMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c12-4-2-7-5-9-8(11-6-7)1-3-10-9/h1,3,5-6,10,12H,2,4H2.
What are the key properties of 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol?
2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol has a molecular weight of 162.19 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanol is sourced from PubChem (CID 89389519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).