C13H22N2 — CID 142447462
ethane;6-methyl-1H-pyrrolo[3,2-b]pyridine;propane (PubChem CID 142447462) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;6-methyl-1H-pyrrolo[3,2-b]pyridine;propane.
| Compound Name | ethane;6-methyl-1H-pyrrolo[3,2-b]pyridine;propane |
|---|---|
| PubChem CID | 142447462 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;6-methyl-1H-pyrrolo[3,2-b]pyridine;propane |
| SMILES | CC.CCC.Cc1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C8H8N2.C3H8.C2H6/c1-6-4-8-7(10-5-6)2-3-9-8;1-3-2;1-2/h2-5,9H,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | OWSUQFFCQPCXDI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |