C10H13N3 — CID 84766983
N-methyl-2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanamine (PubChem CID 84766983) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is N-methyl-2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanamine.
| Compound Name | N-methyl-2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanamine |
|---|---|
| PubChem CID | 84766983 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-methyl-2-(1H-pyrrolo[3,2-b]pyridin-6-yl)ethanamine |
| SMILES | CNCCc1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C10H13N3/c1-11-4-2-8-6-10-9(13-7-8)3-5-12-10/h3,5-7,11-12H,2,4H2,1H3 |
| InChIKey | PGQVDFMIHCOXFJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |