C13H12N2S — CID 162768564
6-(2,5-dimethylthiophen-3-yl)-1H-pyrrolo[3,2-b]pyridine (PubChem CID 162768564) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 6-(2,5-dimethylthiophen-3-yl)-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | 6-(2,5-dimethylthiophen-3-yl)-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 162768564 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 6-(2,5-dimethylthiophen-3-yl)-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Cc1cc(-c2cnc3cc[nH]c3c2)c(C)s1 |
| InChI | InChI=1S/C13H12N2S/c1-8-5-11(9(2)16-8)10-6-13-12(15-7-10)3-4-14-13/h3-7,14H,1-2H3 |
| InChIKey | PVMKWRHOVFPVBO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |