About methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate
methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate (PubChem CID 170468843) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate.
Molecular Properties
| Compound Name | methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate |
| PubChem CID | 170468843 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate |
| SMILES | COC(=O)CC#Cc1ncn[nH]1 |
| InChI | InChI=1S/C7H7N3O2/c1-12-7(11)4-2-3-6-8-5-9-10-6/h5H,4H2,1H3,(H,8,9,10) |
| InChIKey | BYACWWBKYNYURK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate?
The IUPAC name of methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate (CID 170468843) is methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate.
What is the SMILES notation for methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate?
The canonical SMILES for methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate is COC(=O)CC#Cc1ncn[nH]1.
What is the InChIKey of methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate?
The InChIKey is BYACWWBKYNYURK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-12-7(11)4-2-3-6-8-5-9-10-6/h5H,4H2,1H3,(H,8,9,10).
What are the key properties of methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate?
methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate has a molecular weight of 165.15 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate is sourced from PubChem (CID 170468843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).