C7H7N3O2 — CID 170468843
methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate (PubChem CID 170468843) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate.
| Compound Name | methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate |
|---|---|
| PubChem CID | 170468843 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | methyl 4-(1H-1,2,4-triazol-5-yl)but-3-ynoate |
| SMILES | COC(=O)CC#Cc1ncn[nH]1 |
| InChI | InChI=1S/C7H7N3O2/c1-12-7(11)4-2-3-6-8-5-9-10-6/h5H,4H2,1H3,(H,8,9,10) |
| InChIKey | BYACWWBKYNYURK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|