C12H9NOS — CID 170473168
4-(1-benzothiophen-2-yl)but-3-ynamide (PubChem CID 170473168) has the molecular formula C12H9NOS and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-yl)but-3-ynamide.
| Compound Name | 4-(1-benzothiophen-2-yl)but-3-ynamide |
|---|---|
| PubChem CID | 170473168 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-(1-benzothiophen-2-yl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C12H9NOS/c13-12(14)7-3-5-10-8-9-4-1-2-6-11(9)15-10/h1-2,4,6,8H,7H2,(H2,13,14) |
| InChIKey | SOYJFOWVWMWVRM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|