C16H9BrS — CID 3808770
2-[2-(4-bromophenyl)ethynyl]-1-benzothiophene (PubChem CID 3808770) has the molecular formula C16H9BrS and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)ethynyl]-1-benzothiophene.
| Compound Name | 2-[2-(4-bromophenyl)ethynyl]-1-benzothiophene |
|---|---|
| PubChem CID | 3808770 |
| Molecular Formula | C16H9BrS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 2-[2-(4-bromophenyl)ethynyl]-1-benzothiophene |
| SMILES | Brc1ccc(C#Cc2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H9BrS/c17-14-8-5-12(6-9-14)7-10-15-11-13-3-1-2-4-16(13)18-15/h1-6,8-9,11H |
| InChIKey | SFQJBTBQCONHMX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|