C10H8N4O — CID 170473206
4-imidazo[1,2-a]pyrazin-3-ylbut-3-ynamide (PubChem CID 170473206) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyrazin-3-ylbut-3-ynamide.
| Compound Name | 4-imidazo[1,2-a]pyrazin-3-ylbut-3-ynamide |
|---|---|
| PubChem CID | 170473206 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-imidazo[1,2-a]pyrazin-3-ylbut-3-ynamide |
| SMILES | NC(=O)CC#Cc1cnc2cnccn12 |
| InChI | InChI=1S/C10H8N4O/c11-9(15)3-1-2-8-6-13-10-7-12-4-5-14(8)10/h4-7H,3H2,(H2,11,15) |
| InChIKey | NEXUVWWNSAHYPI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|