C21H20N6O3S — CID 17047473
3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-dioxoisoindol-5-yl)propanamide (PubChem CID 17047473) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-dioxoisoindol-5-yl)propanamide.
| Compound Name | 3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-dioxoisoindol-5-yl)propanamide |
|---|---|
| PubChem CID | 17047473 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 3-[[4-amino-5-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-dioxoisoindol-5-yl)propanamide |
| SMILES | Nn1c(CCc2ccccc2)nnc1SCCC(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C21H20N6O3S/c22-27-17(9-6-13-4-2-1-3-5-13)25-26-21(27)31-11-10-18(28)23-14-7-8-15-16(12-14)20(30)24-19(15)29/h1-5,7-8,12H,6,9-11,22H2,(H,23,28)(H,24,29,30) |
| InChIKey | UTGDYNOOMCMNQN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|