C23H24N4O4S — CID 17047717
N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 17047717) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17047717 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(COc2ccccc2)nnc1SCCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H24N4O4S/c1-2-11-27-21(15-29-18-6-4-3-5-7-18)25-26-23(27)32-12-10-22(28)24-14-17-8-9-19-20(13-17)31-16-30-19/h2-9,13H,1,10-12,14-16H2,(H,24,28) |
| InChIKey | MIWFASWNAAHPPP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|