C19H18N4O3S2 — CID 7298501
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 7298501) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7298501 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccc3c(c2)OCO3)nnc1-c1cccs1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-2-7-23-18(16-4-3-8-27-16)21-22-19(23)28-11-17(24)20-10-13-5-6-14-15(9-13)26-12-25-14/h2-6,8-9H,1,7,10-12H2,(H,20,24) |
| InChIKey | DLXMSLTVRNUQBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|