C13H18OS — CID 170478636
4-(4-methoxy-2,5-dimethylphenyl)but-3-ene-1-thiol (PubChem CID 170478636) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 4-(4-methoxy-2,5-dimethylphenyl)but-3-ene-1-thiol.
| Compound Name | 4-(4-methoxy-2,5-dimethylphenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478636 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-(4-methoxy-2,5-dimethylphenyl)but-3-ene-1-thiol |
| SMILES | COc1cc(C)c(C=CCCS)cc1C |
| InChI | InChI=1S/C13H18OS/c1-10-9-13(14-3)11(2)8-12(10)6-4-5-7-15/h4,6,8-9,15H,5,7H2,1-3H3 |
| InChIKey | SPCOBAKJDPIMRX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|