C10H10N6 — CID 170485417
5-(4-azidobut-1-enyl)-1H-pyrazolo[5,4-b]pyridine (PubChem CID 170485417) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-(4-azidobut-1-enyl)-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 5-(4-azidobut-1-enyl)-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 170485417 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-(4-azidobut-1-enyl)-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [N-]=[N+]=NCCC=Cc1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C10H10N6/c11-16-13-4-2-1-3-8-5-9-7-14-15-10(9)12-6-8/h1,3,5-7H,2,4H2,(H,12,14,15) |
| InChIKey | UVUIVDDCPFKCQO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|