C13H20N2O2S — CID 170487837
tert-butyl N-[4-(4-aminobut-1-enyl)thiophen-2-yl]carbamate (PubChem CID 170487837) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is tert-butyl N-[4-(4-aminobut-1-enyl)thiophen-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(4-aminobut-1-enyl)thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 170487837 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | tert-butyl N-[4-(4-aminobut-1-enyl)thiophen-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C=CCCN)cs1 |
| InChI | InChI=1S/C13H20N2O2S/c1-13(2,3)17-12(16)15-11-8-10(9-18-11)6-4-5-7-14/h4,6,8-9H,5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | RUGHKNWJISDIBV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |