C25H23ClN2O2 — CID 170491945
9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-methyl-3-pyridinyl)but-3-enyl]carbamate (PubChem CID 170491945) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-methyl-3-pyridinyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-methyl-3-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491945 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-methyl-3-pyridinyl)but-3-enyl]carbamate |
| SMILES | Cc1ccc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c(Cl)n1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-17-13-14-18(24(26)28-17)8-6-7-15-27-25(29)30-16-23-21-11-4-2-9-19(21)20-10-3-5-12-22(20)23/h2-6,8-14,23H,7,15-16H2,1H3,(H,27,29) |
| InChIKey | RPUCJTCIOCXVAF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|