C20H22BrNO2 — CID 170495136
benzyl N-[4-(4-bromo-2,6-dimethylphenyl)but-3-enyl]carbamate (PubChem CID 170495136) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is benzyl N-[4-(4-bromo-2,6-dimethylphenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(4-bromo-2,6-dimethylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170495136 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | benzyl N-[4-(4-bromo-2,6-dimethylphenyl)but-3-enyl]carbamate |
| SMILES | Cc1cc(Br)cc(C)c1C=CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22BrNO2/c1-15-12-18(21)13-16(2)19(15)10-6-7-11-22-20(23)24-14-17-8-4-3-5-9-17/h3-6,8-10,12-13H,7,11,14H2,1-2H3,(H,22,23) |
| InChIKey | FLPGDYZDFCBCSC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|