C9H9BrF3N3 — CID 170498124
5-(4-bromobut-1-enyl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170498124) has the molecular formula C9H9BrF3N3 and a molecular weight of 296.09 g/mol. Its IUPAC name is 5-(4-bromobut-1-enyl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 5-(4-bromobut-1-enyl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170498124 |
| Molecular Formula | C9H9BrF3N3 |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 5-(4-bromobut-1-enyl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(C=CCCBr)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9BrF3N3/c10-4-2-1-3-6-5-15-8(14)16-7(6)9(11,12)13/h1,3,5H,2,4H2,(H2,14,15,16) |
| InChIKey | RRDWJQNFGJXMDG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|