C11H12ClNO2 — CID 170499563
methyl 2-(4-chlorobut-1-enyl)pyridine-4-carboxylate (PubChem CID 170499563) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is methyl 2-(4-chlorobut-1-enyl)pyridine-4-carboxylate.
| Compound Name | methyl 2-(4-chlorobut-1-enyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 170499563 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl 2-(4-chlorobut-1-enyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(C=CCCCl)c1 |
| InChI | InChI=1S/C11H12ClNO2/c1-15-11(14)9-5-7-13-10(8-9)4-2-3-6-12/h2,4-5,7-8H,3,6H2,1H3 |
| InChIKey | ANVZKKCHSJKHCT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|