C13H14ClFO2 — CID 170499953
3-[4-(4-chlorobut-1-enyl)-2-fluorophenyl]propanoic acid (PubChem CID 170499953) has the molecular formula C13H14ClFO2 and a molecular weight of 256.70 g/mol. Its IUPAC name is 3-[4-(4-chlorobut-1-enyl)-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-(4-chlorobut-1-enyl)-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 170499953 |
| Molecular Formula | C13H14ClFO2 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-[4-(4-chlorobut-1-enyl)-2-fluorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C=CCCCl)cc1F |
| InChI | InChI=1S/C13H14ClFO2/c14-8-2-1-3-10-4-5-11(12(15)9-10)6-7-13(16)17/h1,3-5,9H,2,6-8H2,(H,16,17) |
| InChIKey | FUSZKTAFVWXVMQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|