C10H10O4S — CID 170500463
4-(4-methoxy-4-oxobut-1-enyl)thiophene-3-carboxylic acid (PubChem CID 170500463) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 4-(4-methoxy-4-oxobut-1-enyl)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-methoxy-4-oxobut-1-enyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 170500463 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-(4-methoxy-4-oxobut-1-enyl)thiophene-3-carboxylic acid |
| SMILES | COC(=O)CC=Cc1cscc1C(=O)O |
| InChI | InChI=1S/C10H10O4S/c1-14-9(11)4-2-3-7-5-15-6-8(7)10(12)13/h2-3,5-6H,4H2,1H3,(H,12,13) |
| InChIKey | VSUCMOAKBCGIHT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |