C15H12BrN3O7 — CID 17050066
2-(4-bromophenoxy)-N-(4-methoxy-3,5-dinitrophenyl)acetamide (PubChem CID 17050066) has the molecular formula C15H12BrN3O7 and a molecular weight of 426.18 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-(4-methoxy-3,5-dinitrophenyl)acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-(4-methoxy-3,5-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 17050066 |
| Molecular Formula | C15H12BrN3O7 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2-(4-bromophenoxy)-N-(4-methoxy-3,5-dinitrophenyl)acetamide |
| SMILES | COc1c([N+](=O)[O-])cc(NC(=O)COc2ccc(Br)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12BrN3O7/c1-25-15-12(18(21)22)6-10(7-13(15)19(23)24)17-14(20)8-26-11-4-2-9(16)3-5-11/h2-7H,8H2,1H3,(H,17,20) |
| InChIKey | COYVTHGFKMNLLZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|